C23H31FN4O2S — CID 145156855
ethane;(E)-3-[2-[4-[[6-(2-fluoropropan-2-yl)-3-pyridinyl]sulfanyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 145156855) has the molecular formula C23H31FN4O2S and a molecular weight of 446.59 g/mol. Its IUPAC name is ethane;(E)-3-[2-[4-[[6-(2-fluoropropan-2-yl)-3-pyridinyl]sulfanyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | ethane;(E)-3-[2-[4-[[6-(2-fluoropropan-2-yl)-3-pyridinyl]sulfanyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 145156855 |
| Molecular Formula | C23H31FN4O2S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | ethane;(E)-3-[2-[4-[[6-(2-fluoropropan-2-yl)-3-pyridinyl]sulfanyl]piperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CC.CC(C)(F)c1ccc(SN2CCN(c3ccccc3/C=C/C(=O)NO)CC2)cn1 |
| InChI | InChI=1S/C21H25FN4O2S.C2H6/c1-21(2,22)19-9-8-17(15-23-19)29-26-13-11-25(12-14-26)18-6-4-3-5-16(18)7-10-20(27)24-28;1-2/h3-10,15,28H,11-14H2,1-2H3,(H,24,27);1-2H3/b10-7+; |
| InChIKey | NFQFSNHTXDYEJJ-HCUGZAAXSA-N |
| XLogP | 4.66 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|