C20H27N3O4 — CID 122535860
tert-butyl 5-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,5-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 122535860) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 5-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,5-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 5-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,5-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 122535860 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl 5-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,5-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCN2c2ccccc2/C=C/C(=O)NO)C1 |
| InChI | InChI=1S/C20H27N3O4/c1-19(2,3)27-18(25)22-13-20(14-22)11-6-12-23(20)16-8-5-4-7-15(16)9-10-17(24)21-26/h4-5,7-10,26H,6,11-14H2,1-3H3,(H,21,24)/b10-9+ |
| InChIKey | QHVBTKLEVQHIDI-MDZDMXLPSA-N |
| XLogP | 2.79 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|