C17H18ClN3O2S2 — CID 145156878
(E)-3-[2-[4-(5-chlorothiophen-2-yl)sulfanylpiperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 145156878) has the molecular formula C17H18ClN3O2S2 and a molecular weight of 395.94 g/mol. Its IUPAC name is (E)-3-[2-[4-(5-chlorothiophen-2-yl)sulfanylpiperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[4-(5-chlorothiophen-2-yl)sulfanylpiperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 145156878 |
| Molecular Formula | C17H18ClN3O2S2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (E)-3-[2-[4-(5-chlorothiophen-2-yl)sulfanylpiperazin-1-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCN(Sc2ccc(Cl)s2)CC1)NO |
| InChI | InChI=1S/C17H18ClN3O2S2/c18-15-6-8-17(24-15)25-21-11-9-20(10-12-21)14-4-2-1-3-13(14)5-7-16(22)19-23/h1-8,23H,9-12H2,(H,19,22)/b7-5+ |
| InChIKey | LFFYMZVZGLXULC-FNORWQNLSA-N |
| XLogP | 3.75 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|