C15H18FN5 — CID 168629407
1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629407) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629407 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(N3CCCC3)c(F)c2)c(N)n1 |
| InChI | InChI=1S/C15H18FN5/c1-11-10-21(15(17)19-11)18-9-12-4-5-14(13(16)8-12)20-6-2-3-7-20/h4-5,8-10H,2-3,6-7H2,1H3,(H2,17,19) |
| InChIKey | UKUNNQAGEUPZSE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|