C18H24FN5 — CID 168629050
1-[[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629050) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629050 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[[3-fluoro-4-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(CN3CCC(C)CC3)c(F)c2)c(N)n1 |
| InChI | InChI=1S/C18H24FN5/c1-13-5-7-23(8-6-13)12-16-4-3-15(9-17(16)19)10-21-24-11-14(2)22-18(24)20/h3-4,9-11,13H,5-8,12H2,1-2H3,(H2,20,22) |
| InChIKey | VERLEJVRFBHQHH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|