C18H16N4O2 — CID 168631010
2-[3-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]benzoic acid (PubChem CID 168631010) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[3-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]benzoic acid.
| Compound Name | 2-[3-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 168631010 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[3-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]benzoic acid |
| SMILES | Cc1cn(N=Cc2cccc(-c3ccccc3C(=O)O)c2)c(N)n1 |
| InChI | InChI=1S/C18H16N4O2/c1-12-11-22(18(19)21-12)20-10-13-5-4-6-14(9-13)15-7-2-3-8-16(15)17(23)24/h2-11H,1H3,(H2,19,21)(H,23,24) |
| InChIKey | CWWPMSUBUQHANM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|