C15H20N4S — CID 168628982
1-[(3-butylsulfanylphenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168628982) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-[(3-butylsulfanylphenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(3-butylsulfanylphenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168628982 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[(3-butylsulfanylphenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCCCSc1cccc(C=Nn2cc(C)nc2N)c1 |
| InChI | InChI=1S/C15H20N4S/c1-3-4-8-20-14-7-5-6-13(9-14)10-17-19-11-12(2)18-15(19)16/h5-7,9-11H,3-4,8H2,1-2H3,(H2,16,18) |
| InChIKey | OMUNVVMFBXBGKZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|