C20H31N5 — CID 168629107
1-[[3-[(dibutylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629107) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[[3-[(dibutylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-[(dibutylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629107 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 1-[[3-[(dibutylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCCCN(CCCC)Cc1cccc(C=Nn2cc(C)nc2N)c1 |
| InChI | InChI=1S/C20H31N5/c1-4-6-11-24(12-7-5-2)16-19-10-8-9-18(13-19)14-22-25-15-17(3)23-20(25)21/h8-10,13-15H,4-7,11-12,16H2,1-3H3,(H2,21,23) |
| InChIKey | DZIQTAORVAHBIN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|