C17H24N4O — CID 168628935
4-methyl-1-[(3-methyl-4-pentoxyphenyl)methylideneamino]imidazol-2-amine (PubChem CID 168628935) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-methyl-1-[(3-methyl-4-pentoxyphenyl)methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[(3-methyl-4-pentoxyphenyl)methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168628935 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-methyl-1-[(3-methyl-4-pentoxyphenyl)methylideneamino]imidazol-2-amine |
| SMILES | CCCCCOc1ccc(C=Nn2cc(C)nc2N)cc1C |
| InChI | InChI=1S/C17H24N4O/c1-4-5-6-9-22-16-8-7-15(10-13(16)2)11-19-21-12-14(3)20-17(21)18/h7-8,10-12H,4-6,9H2,1-3H3,(H2,18,20) |
| InChIKey | UROUNZRYLAEPHR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|