C17H22F2N4O — CID 168628950
1-[(3,4-difluoro-5-hexoxyphenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168628950) has the molecular formula C17H22F2N4O and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[(3,4-difluoro-5-hexoxyphenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(3,4-difluoro-5-hexoxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168628950 |
| Molecular Formula | C17H22F2N4O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(3,4-difluoro-5-hexoxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCCCCCOc1cc(C=Nn2cc(C)nc2N)cc(F)c1F |
| InChI | InChI=1S/C17H22F2N4O/c1-3-4-5-6-7-24-15-9-13(8-14(18)16(15)19)10-21-23-11-12(2)22-17(23)20/h8-11H,3-7H2,1-2H3,(H2,20,22) |
| InChIKey | MTRZJTDLDIAUHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|