C18H27N5 — CID 168629127
1-[[3-[(dipropylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629127) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-[[3-[(dipropylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-[(dipropylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629127 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-[[3-[(dipropylamino)methyl]phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCCN(CCC)Cc1cccc(C=Nn2cc(C)nc2N)c1 |
| InChI | InChI=1S/C18H27N5/c1-4-9-22(10-5-2)14-17-8-6-7-16(11-17)12-20-23-13-15(3)21-18(23)19/h6-8,11-13H,4-5,9-10,14H2,1-3H3,(H2,19,21) |
| InChIKey | RGXJDMIJAPFALD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|