C14H12FN5 — CID 168629682
1-[(7-fluoroquinolin-6-yl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629682) has the molecular formula C14H12FN5 and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-[(7-fluoroquinolin-6-yl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(7-fluoroquinolin-6-yl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629682 |
| Molecular Formula | C14H12FN5 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-[(7-fluoroquinolin-6-yl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2cc3cccnc3cc2F)c(N)n1 |
| InChI | InChI=1S/C14H12FN5/c1-9-8-20(14(16)19-9)18-7-11-5-10-3-2-4-17-13(10)6-12(11)15/h2-8H,1H3,(H2,16,19) |
| InChIKey | RGFLOBUSBFROCO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|