C11H9BrFN5O2 — CID 168631357
1-[(2-bromo-5-fluoro-4-nitrophenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168631357) has the molecular formula C11H9BrFN5O2 and a molecular weight of 342.13 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluoro-4-nitrophenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(2-bromo-5-fluoro-4-nitrophenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168631357 |
| Molecular Formula | C11H9BrFN5O2 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-[(2-bromo-5-fluoro-4-nitrophenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2cc(F)c([N+](=O)[O-])cc2Br)c(N)n1 |
| InChI | InChI=1S/C11H9BrFN5O2/c1-6-5-17(11(14)16-6)15-4-7-2-9(13)10(18(19)20)3-8(7)12/h2-5H,1H3,(H2,14,16) |
| InChIKey | WWVAXMLVGDDJEC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|