C15H19BrN4O2 — CID 168629902
1-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629902) has the molecular formula C15H19BrN4O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629902 |
| Molecular Formula | C15H19BrN4O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | COc1cc(C=Nn2cc(C)nc2N)c(Br)cc1OC(C)C |
| InChI | InChI=1S/C15H19BrN4O2/c1-9(2)22-14-6-12(16)11(5-13(14)21-4)7-18-20-8-10(3)19-15(20)17/h5-9H,1-4H3,(H2,17,19) |
| InChIKey | NFYDNIUZQUSEJT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|