C10H6Cl2N2O2 — CID 170800343
4-(4,5-dichloro-2-nitrophenyl)but-3-enenitrile (PubChem CID 170800343) has the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.08 g/mol. Its IUPAC name is 4-(4,5-dichloro-2-nitrophenyl)but-3-enenitrile.
| Compound Name | 4-(4,5-dichloro-2-nitrophenyl)but-3-enenitrile |
|---|---|
| PubChem CID | 170800343 |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 4-(4,5-dichloro-2-nitrophenyl)but-3-enenitrile |
| SMILES | N#CCC=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-8-5-7(3-1-2-4-13)10(14(15)16)6-9(8)12/h1,3,5-6H,2H2 |
| InChIKey | XCYBVYQGIQPNGQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|