C20H14Cl2FNO4S — CID 98545115
3-chloro-4-[(1Z,3Z,5E,7Z)-8-(2-chloro-4-nitrophenyl)octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride (PubChem CID 98545115) has the molecular formula C20H14Cl2FNO4S and a molecular weight of 454.31 g/mol. Its IUPAC name is 3-chloro-4-[(1Z,3Z,5E,7Z)-8-(2-chloro-4-nitrophenyl)octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride.
| Compound Name | 3-chloro-4-[(1Z,3Z,5E,7Z)-8-(2-chloro-4-nitrophenyl)octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 98545115 |
| Molecular Formula | C20H14Cl2FNO4S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 3-chloro-4-[(1Z,3Z,5E,7Z)-8-(2-chloro-4-nitrophenyl)octa-1,3,5,7-tetraenyl]benzenesulfonyl fluoride |
| SMILES | O=[N+]([O-])c1ccc(/C=C\C=C\C=C/C=C\c2ccc(S(=O)(=O)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2FNO4S/c21-19-13-17(24(25)26)11-9-15(19)7-5-3-1-2-4-6-8-16-10-12-18(14-20(16)22)29(23,27)28/h1-14H/b3-1+,4-2-,7-5-,8-6- |
| InChIKey | SHZNFIGKFGQLTO-VMFLRNLLSA-N |
| XLogP | 6.40 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|