C44H48N6O8 — CID 21188853
N,N,N',N'-tetrakis[(E)-3-(2-nitrophenyl)prop-2-enyl]octane-1,8-diamine (PubChem CID 21188853) has the molecular formula C44H48N6O8 and a molecular weight of 788.90 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(E)-3-(2-nitrophenyl)prop-2-enyl]octane-1,8-diamine.
| Compound Name | N,N,N',N'-tetrakis[(E)-3-(2-nitrophenyl)prop-2-enyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 21188853 |
| Molecular Formula | C44H48N6O8 |
| Molecular Weight | 788.90 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | N,N,N',N'-tetrakis[(E)-3-(2-nitrophenyl)prop-2-enyl]octane-1,8-diamine |
| SMILES | O=[N+]([O-])c1ccccc1/C=C/CN(C/C=C/c1ccccc1[N+](=O)[O-])CCCCCCCCN(C/C=C/c1ccccc1[N+](=O)[O-])C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C44H48N6O8/c51-47(52)41-27-9-5-19-37(41)23-15-33-45(34-16-24-38-20-6-10-28-42(38)48(53)54)31-13-3-1-2-4-14-32-46(35-17-25-39-21-7-11-29-43(39)49(55)56)36-18-26-40-22-8-12-30-44(40)50(57)58/h5-12,15-30H,1-4,13-14,31-36H2/b23-15+,24-16+,25-17+,26-18+ |
| InChIKey | FWYGNKKLIWRIIT-BDVUCFRDSA-N |
| XLogP | 10.42 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.90 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|