C15H10ClF2NO — CID 75618948
3-(3-chlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide (PubChem CID 75618948) has the molecular formula C15H10ClF2NO and a molecular weight of 293.70 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75618948 |
| Molecular Formula | C15H10ClF2NO |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H10ClF2NO/c16-11-4-1-3-10(9-11)7-8-14(20)19-15-12(17)5-2-6-13(15)18/h1-9H,(H,19,20) |
| InChIKey | WWKYCOOONCTLRC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|