C15H9ClF3NO — CID 2521630
(E)-3-(3-chlorophenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 2521630) has the molecular formula C15H9ClF3NO and a molecular weight of 311.69 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2521630 |
| Molecular Formula | C15H9ClF3NO |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9ClF3NO/c16-10-3-1-2-9(8-10)4-7-13(21)20-12-6-5-11(17)14(18)15(12)19/h1-8H,(H,20,21)/b7-4+ |
| InChIKey | JUQFHFCHKLJYHE-QPJJXVBHSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|