C16H12ClNO4 — CID 108766495
4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-3-hydroxybenzoic acid (PubChem CID 108766495) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is 4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108766495 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-3-hydroxybenzoic acid |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C16H12ClNO4/c17-12-3-1-2-10(8-12)4-7-15(20)18-13-6-5-11(16(21)22)9-14(13)19/h1-9,19H,(H,18,20)(H,21,22)/b7-4+ |
| InChIKey | WQHZPYKBAPFCIR-QPJJXVBHSA-N |
| XLogP | 3.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|