C14H11NO4 — CID 170746428
(E)-3-pyridin-2-yl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 170746428) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is (E)-3-pyridin-2-yl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-pyridin-2-yl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 170746428 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (E)-3-pyridin-2-yl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccn1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C14H11NO4/c16-11(6-4-9-3-1-2-8-15-9)10-5-7-12(17)14(19)13(10)18/h1-8,17-19H/b6-4+ |
| InChIKey | IREPXCQQWBUOPK-GQCTYLIASA-N |
| XLogP | 2.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|