C24H29N3O4 — CID 44578811
(E)-1-[3-hydroxy-2,4-bis(morpholin-4-ylmethyl)phenyl]-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 44578811) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (E)-1-[3-hydroxy-2,4-bis(morpholin-4-ylmethyl)phenyl]-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[3-hydroxy-2,4-bis(morpholin-4-ylmethyl)phenyl]-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 44578811 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (E)-1-[3-hydroxy-2,4-bis(morpholin-4-ylmethyl)phenyl]-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccn1)c1ccc(CN2CCOCC2)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C24H29N3O4/c28-23(7-5-20-3-1-2-8-25-20)21-6-4-19(17-26-9-13-30-14-10-26)24(29)22(21)18-27-11-15-31-16-12-27/h1-8,29H,9-18H2/b7-5+ |
| InChIKey | XODVTQXZPIYECV-FNORWQNLSA-N |
| XLogP | 2.35 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|