C21H25NO4S — CID 44578547
(E)-1-[2-hydroxy-3-(morpholin-4-ylmethyl)-4-propan-2-yloxyphenyl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 44578547) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-3-(morpholin-4-ylmethyl)-4-propan-2-yloxyphenyl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-3-(morpholin-4-ylmethyl)-4-propan-2-yloxyphenyl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 44578547 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (E)-1-[2-hydroxy-3-(morpholin-4-ylmethyl)-4-propan-2-yloxyphenyl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | CC(C)Oc1ccc(C(=O)/C=C/c2cccs2)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C21H25NO4S/c1-15(2)26-20-8-6-17(19(23)7-5-16-4-3-13-27-16)21(24)18(20)14-22-9-11-25-12-10-22/h3-8,13,15,24H,9-12,14H2,1-2H3/b7-5+ |
| InChIKey | AUMVJRDKXYUGHG-FNORWQNLSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|