C19H17NO4 — CID 78873903
(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 78873903) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78873903 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2c[nH]c3ccccc23)cc(OC)c1O |
| InChI | InChI=1S/C19H17NO4/c1-23-17-9-12(10-18(24-2)19(17)22)7-8-16(21)14-11-20-15-6-4-3-5-13(14)15/h3-11,20,22H,1-2H3/b8-7+ |
| InChIKey | XNFSRWYXONIRSQ-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|