C21H20N2O6 — CID 76533606
3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(5-hydroxy-1H-indol-3-yl)-2-oxoethyl]prop-2-enamide (PubChem CID 76533606) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(5-hydroxy-1H-indol-3-yl)-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(5-hydroxy-1H-indol-3-yl)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 76533606 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(5-hydroxy-1H-indol-3-yl)-2-oxoethyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCC(=O)c2c[nH]c3ccc(O)cc23)cc(OC)c1O |
| InChI | InChI=1S/C21H20N2O6/c1-28-18-7-12(8-19(29-2)21(18)27)3-6-20(26)23-11-17(25)15-10-22-16-5-4-13(24)9-14(15)16/h3-10,22,24,27H,11H2,1-2H3,(H,23,26) |
| InChIKey | QAOPXDWEBPYEBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|