C15H15NO3 — CID 105122790
(2,3-dimethoxyphenyl)-(5-methyl-3-pyridinyl)methanone (PubChem CID 105122790) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-(5-methyl-3-pyridinyl)methanone.
| Compound Name | (2,3-dimethoxyphenyl)-(5-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 105122790 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2,3-dimethoxyphenyl)-(5-methyl-3-pyridinyl)methanone |
| SMILES | COc1cccc(C(=O)c2cncc(C)c2)c1OC |
| InChI | InChI=1S/C15H15NO3/c1-10-7-11(9-16-8-10)14(17)12-5-4-6-13(18-2)15(12)19-3/h4-9H,1-3H3 |
| InChIKey | QWIWLKBUDPIOSJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |