C15H15NO4 — CID 115793508
(2,6-dimethoxyphenyl)-(5-methoxy-3-pyridinyl)methanone (PubChem CID 115793508) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(5-methoxy-3-pyridinyl)methanone.
| Compound Name | (2,6-dimethoxyphenyl)-(5-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 115793508 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(5-methoxy-3-pyridinyl)methanone |
| SMILES | COc1cncc(C(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C15H15NO4/c1-18-11-7-10(8-16-9-11)15(17)14-12(19-2)5-4-6-13(14)20-3/h4-9H,1-3H3 |
| InChIKey | WQDMKAZMFAHGEQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |