C13H15N3 — CID 82471042
2-(4,6-dimethylpyrimidin-2-yl)-4-methylaniline (PubChem CID 82471042) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-4-methylaniline.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-4-methylaniline |
|---|---|
| PubChem CID | 82471042 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-4-methylaniline |
| SMILES | Cc1ccc(N)c(-c2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C13H15N3/c1-8-4-5-12(14)11(6-8)13-15-9(2)7-10(3)16-13/h4-7H,14H2,1-3H3 |
| InChIKey | ICOKNVGRZMADBD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|