C12H7Cl4NS — CID 54505726
2,3-dichloro-4-(2,4-dichlorophenyl)sulfanylaniline (PubChem CID 54505726) has the molecular formula C12H7Cl4NS and a molecular weight of 339.07 g/mol. Its IUPAC name is 2,3-dichloro-4-(2,4-dichlorophenyl)sulfanylaniline.
| Compound Name | 2,3-dichloro-4-(2,4-dichlorophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 54505726 |
| Molecular Formula | C12H7Cl4NS |
| Molecular Weight | 339.07 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2,3-dichloro-4-(2,4-dichlorophenyl)sulfanylaniline |
| SMILES | Nc1ccc(Sc2ccc(Cl)cc2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H7Cl4NS/c13-6-1-3-9(7(14)5-6)18-10-4-2-8(17)11(15)12(10)16/h1-5H,17H2 |
| InChIKey | YFOGQOJGFZQERZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.07 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|