C10H8Cl2N2S2 — CID 121215661
5-(2,4-dichlorophenyl)sulfanyl-4-methyl-1,3-thiazol-2-amine (PubChem CID 121215661) has the molecular formula C10H8Cl2N2S2 and a molecular weight of 291.23 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)sulfanyl-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(2,4-dichlorophenyl)sulfanyl-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 121215661 |
| Molecular Formula | C10H8Cl2N2S2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 5-(2,4-dichlorophenyl)sulfanyl-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2S2/c1-5-9(16-10(13)14-5)15-8-3-2-6(11)4-7(8)12/h2-4H,1H3,(H2,13,14) |
| InChIKey | WRWAAQZPBKTHGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |