C12H12Cl2N2S — CID 28864558
4-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 28864558) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28864558 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)c1sc(N)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2S/c1-6(2)11-10(16-12(15)17-11)8-4-3-7(13)5-9(8)14/h3-6H,1-2H3,(H2,15,16) |
| InChIKey | XBXBRFLNYWYLGM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |