About 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine
2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine (PubChem CID 63467471) has the molecular formula C16H21Cl2N3
and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine |
| PubChem CID | 63467471 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine |
| SMILES | CC(C)n1c(C(C)(C)C)nc(-c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C16H21Cl2N3/c1-9(2)21-14(19)13(20-15(21)16(3,4)5)11-7-6-10(17)8-12(11)18/h6-9H,19H2,1-5H3 |
| InChIKey | PXKUKIJTYIIKOD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine?
The IUPAC name of 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine (CID 63467471) is 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine.
What is the SMILES notation for 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine?
The canonical SMILES for 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine is CC(C)n1c(C(C)(C)C)nc(-c2ccc(Cl)cc2Cl)c1N.
What is the InChIKey of 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine?
The InChIKey is PXKUKIJTYIIKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3/c1-9(2)21-14(19)13(20-15(21)16(3,4)5)11-7-6-10(17)8-12(11)18/h6-9H,19H2,1-5H3.
What are the key properties of 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine?
2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine has a molecular weight of 326.27 g/mol, XLogP of 5.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2,4-dichlorophenyl)-3-propan-2-ylimidazol-4-amine is sourced from PubChem (CID 63467471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).