C13H14Cl2N2O — CID 70139487
2-tert-butyl-4-(2,4-dichlorophenyl)-1-hydroxyimidazole (PubChem CID 70139487) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-tert-butyl-4-(2,4-dichlorophenyl)-1-hydroxyimidazole.
| Compound Name | 2-tert-butyl-4-(2,4-dichlorophenyl)-1-hydroxyimidazole |
|---|---|
| PubChem CID | 70139487 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-tert-butyl-4-(2,4-dichlorophenyl)-1-hydroxyimidazole |
| SMILES | CC(C)(C)c1nc(-c2ccc(Cl)cc2Cl)cn1O |
| InChI | InChI=1S/C13H14Cl2N2O/c1-13(2,3)12-16-11(7-17(12)18)9-5-4-8(14)6-10(9)15/h4-7,18H,1-3H3 |
| InChIKey | YDSZFCPLCKBYIS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|