C14H12Cl3IN2 — CID 66314197
4-tert-butyl-6-chloro-2-(2,4-dichlorophenyl)-5-iodopyrimidine (PubChem CID 66314197) has the molecular formula C14H12Cl3IN2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-tert-butyl-6-chloro-2-(2,4-dichlorophenyl)-5-iodopyrimidine.
| Compound Name | 4-tert-butyl-6-chloro-2-(2,4-dichlorophenyl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 66314197 |
| Molecular Formula | C14H12Cl3IN2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | 4-tert-butyl-6-chloro-2-(2,4-dichlorophenyl)-5-iodopyrimidine |
| SMILES | CC(C)(C)c1nc(-c2ccc(Cl)cc2Cl)nc(Cl)c1I |
| InChI | InChI=1S/C14H12Cl3IN2/c1-14(2,3)11-10(18)12(17)20-13(19-11)8-5-4-7(15)6-9(8)16/h4-6H,1-3H3 |
| InChIKey | ZVTUAYKNVXTTDN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|