C13H11Cl2IN2 — CID 89358004
2-(2,4-dichlorophenyl)-4-(iodomethyl)-5,6-dimethylpyrimidine (PubChem CID 89358004) has the molecular formula C13H11Cl2IN2 and a molecular weight of 393.06 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-(iodomethyl)-5,6-dimethylpyrimidine.
| Compound Name | 2-(2,4-dichlorophenyl)-4-(iodomethyl)-5,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 89358004 |
| Molecular Formula | C13H11Cl2IN2 |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-(iodomethyl)-5,6-dimethylpyrimidine |
| SMILES | Cc1nc(-c2ccc(Cl)cc2Cl)nc(CI)c1C |
| InChI | InChI=1S/C13H11Cl2IN2/c1-7-8(2)17-13(18-12(7)6-16)10-4-3-9(14)5-11(10)15/h3-5H,6H2,1-2H3 |
| InChIKey | HJPJPQQGSDJKFH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|