C10H9Cl2N3O2S2 — CID 63946583
2-amino-N-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 63946583) has the molecular formula C10H9Cl2N3O2S2 and a molecular weight of 338.24 g/mol. Its IUPAC name is 2-amino-N-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63946583 |
| Molecular Formula | C10H9Cl2N3O2S2 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 2-amino-N-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2N3O2S2/c1-5-9(18-10(13)14-5)19(16,17)15-8-3-2-6(11)4-7(8)12/h2-4,15H,1H3,(H2,13,14) |
| InChIKey | WNMTWYSTDMSHKQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |