C10H8BrF2N3O2S2 — CID 107613618
2-amino-N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 107613618) has the molecular formula C10H8BrF2N3O2S2 and a molecular weight of 384.23 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 107613618 |
| Molecular Formula | C10H8BrF2N3O2S2 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2-amino-N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H8BrF2N3O2S2/c1-4-9(19-10(14)15-4)20(17,18)16-8-3-6(12)5(11)2-7(8)13/h2-3,16H,1H3,(H2,14,15) |
| InChIKey | DSLIUAZVFOYUTL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|