C12H14N2S3 — CID 79222133
4-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 79222133) has the molecular formula C12H14N2S3 and a molecular weight of 282.46 g/mol. Its IUPAC name is 4-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79222133 |
| Molecular Formula | C12H14N2S3 |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCCSc1ccccc1 |
| InChI | InChI=1S/C12H14N2S3/c1-9-11(17-12(13)14-9)16-8-7-15-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H2,13,14) |
| InChIKey | SEXKWFAVSDAQHH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|