C12H14N2OS2 — CID 102939748
4-methyl-5-(phenylmethoxymethylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 102939748) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-methyl-5-(phenylmethoxymethylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-(phenylmethoxymethylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102939748 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-methyl-5-(phenylmethoxymethylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCOCc1ccccc1 |
| InChI | InChI=1S/C12H14N2OS2/c1-9-11(17-12(13)14-9)16-8-15-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H2,13,14) |
| InChIKey | CQQAUUYSONUUSY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|