C9H17N3S2 — CID 114525516
5-[3-(dimethylamino)propylsulfanyl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 114525516) has the molecular formula C9H17N3S2 and a molecular weight of 231.39 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylsulfanyl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-[3-(dimethylamino)propylsulfanyl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114525516 |
| Molecular Formula | C9H17N3S2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-[3-(dimethylamino)propylsulfanyl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCCCN(C)C |
| InChI | InChI=1S/C9H17N3S2/c1-7-8(14-9(10)11-7)13-6-4-5-12(2)3/h4-6H2,1-3H3,(H2,10,11) |
| InChIKey | HLIBLEKSMANTMB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|