C14H18N2OS2 — CID 43250718
5-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 43250718) has the molecular formula C14H18N2OS2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 5-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43250718 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)cc(OCCSc2sc(N)nc2C)c1 |
| InChI | InChI=1S/C14H18N2OS2/c1-9-6-10(2)8-12(7-9)17-4-5-18-13-11(3)16-14(15)19-13/h6-8H,4-5H2,1-3H3,(H2,15,16) |
| InChIKey | SVEDMNYMOLNROX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|