C22H25NOS — CID 39774426
2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4,6,8-trimethylquinoline (PubChem CID 39774426) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4,6,8-trimethylquinoline.
| Compound Name | 2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4,6,8-trimethylquinoline |
|---|---|
| PubChem CID | 39774426 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]-4,6,8-trimethylquinoline |
| SMILES | Cc1cc(C)cc(OCCSc2cc(C)c3cc(C)cc(C)c3n2)c1 |
| InChI | InChI=1S/C22H25NOS/c1-14-8-15(2)11-19(10-14)24-6-7-25-21-13-17(4)20-12-16(3)9-18(5)22(20)23-21/h8-13H,6-7H2,1-5H3 |
| InChIKey | OATRRRNICSXRAB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|