C20H21NOS — CID 39774376
4,8-dimethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]quinoline (PubChem CID 39774376) has the molecular formula C20H21NOS and a molecular weight of 323.46 g/mol. Its IUPAC name is 4,8-dimethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]quinoline.
| Compound Name | 4,8-dimethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]quinoline |
|---|---|
| PubChem CID | 39774376 |
| Molecular Formula | C20H21NOS |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4,8-dimethyl-2-[2-(3-methylphenoxy)ethylsulfanyl]quinoline |
| SMILES | Cc1cccc(OCCSc2cc(C)c3cccc(C)c3n2)c1 |
| InChI | InChI=1S/C20H21NOS/c1-14-6-4-8-17(12-14)22-10-11-23-19-13-16(3)18-9-5-7-15(2)20(18)21-19/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | KINNSOQPISYCHW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|