C23H27NOS — CID 39774422
2-[3-(4-ethylphenoxy)propylsulfanyl]-4,6,8-trimethylquinoline (PubChem CID 39774422) has the molecular formula C23H27NOS and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-[3-(4-ethylphenoxy)propylsulfanyl]-4,6,8-trimethylquinoline.
| Compound Name | 2-[3-(4-ethylphenoxy)propylsulfanyl]-4,6,8-trimethylquinoline |
|---|---|
| PubChem CID | 39774422 |
| Molecular Formula | C23H27NOS |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-[3-(4-ethylphenoxy)propylsulfanyl]-4,6,8-trimethylquinoline |
| SMILES | CCc1ccc(OCCCSc2cc(C)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C23H27NOS/c1-5-19-7-9-20(10-8-19)25-11-6-12-26-22-15-17(3)21-14-16(2)13-18(4)23(21)24-22/h7-10,13-15H,5-6,11-12H2,1-4H3 |
| InChIKey | KTEOYLJIKBPMRR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|