About 2-benzylsulfanyl-4,6,8-trimethylquinoline
2-benzylsulfanyl-4,6,8-trimethylquinoline (PubChem CID 46302755) has the molecular formula C19H19NS
and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-benzylsulfanyl-4,6,8-trimethylquinoline.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-4,6,8-trimethylquinoline |
| PubChem CID | 46302755 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-benzylsulfanyl-4,6,8-trimethylquinoline |
| SMILES | Cc1cc(C)c2nc(SCc3ccccc3)cc(C)c2c1 |
| InChI | InChI=1S/C19H19NS/c1-13-9-15(3)19-17(10-13)14(2)11-18(20-19)21-12-16-7-5-4-6-8-16/h4-11H,12H2,1-3H3 |
| InChIKey | JBTJIBBJINCAPR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylsulfanyl-4,6,8-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-4,6,8-trimethylquinoline?
The IUPAC name of 2-benzylsulfanyl-4,6,8-trimethylquinoline (CID 46302755) is 2-benzylsulfanyl-4,6,8-trimethylquinoline.
What is the SMILES notation for 2-benzylsulfanyl-4,6,8-trimethylquinoline?
The canonical SMILES for 2-benzylsulfanyl-4,6,8-trimethylquinoline is Cc1cc(C)c2nc(SCc3ccccc3)cc(C)c2c1.
What is the InChIKey of 2-benzylsulfanyl-4,6,8-trimethylquinoline?
The InChIKey is JBTJIBBJINCAPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NS/c1-13-9-15(3)19-17(10-13)14(2)11-18(20-19)21-12-16-7-5-4-6-8-16/h4-11H,12H2,1-3H3.
What are the key properties of 2-benzylsulfanyl-4,6,8-trimethylquinoline?
2-benzylsulfanyl-4,6,8-trimethylquinoline has a molecular weight of 293.43 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-4,6,8-trimethylquinoline is sourced from PubChem (CID 46302755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).