C11H6BrCl2NS — CID 163687484
5-bromo-2-(2,4-dichlorophenyl)sulfanylpyridine (PubChem CID 163687484) has the molecular formula C11H6BrCl2NS and a molecular weight of 335.05 g/mol. Its IUPAC name is 5-bromo-2-(2,4-dichlorophenyl)sulfanylpyridine.
| Compound Name | 5-bromo-2-(2,4-dichlorophenyl)sulfanylpyridine |
|---|---|
| PubChem CID | 163687484 |
| Molecular Formula | C11H6BrCl2NS |
| Molecular Weight | 335.05 g/mol |
| Exact Mass | 332.88 |
| IUPAC Name | 5-bromo-2-(2,4-dichlorophenyl)sulfanylpyridine |
| SMILES | Clc1ccc(Sc2ccc(Br)cn2)c(Cl)c1 |
| InChI | InChI=1S/C11H6BrCl2NS/c12-7-1-4-11(15-6-7)16-10-3-2-8(13)5-9(10)14/h1-6H |
| InChIKey | JQCCPNLIHIWXTO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.05 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |