C13H9BrCl3N — CID 143396653
5-bromo-2-[2-chloro-1-(2,4-dichlorophenyl)ethyl]pyridine (PubChem CID 143396653) has the molecular formula C13H9BrCl3N and a molecular weight of 365.49 g/mol. Its IUPAC name is 5-bromo-2-[2-chloro-1-(2,4-dichlorophenyl)ethyl]pyridine.
| Compound Name | 5-bromo-2-[2-chloro-1-(2,4-dichlorophenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 143396653 |
| Molecular Formula | C13H9BrCl3N |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 362.90 |
| IUPAC Name | 5-bromo-2-[2-chloro-1-(2,4-dichlorophenyl)ethyl]pyridine |
| SMILES | ClCC(c1ccc(Br)cn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9BrCl3N/c14-8-1-4-13(18-7-8)11(6-15)10-3-2-9(16)5-12(10)17/h1-5,7,11H,6H2 |
| InChIKey | KBOXPLZDVBCEKY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|