C13H7BrCl2N2 — CID 21354222
5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine (PubChem CID 21354222) has the molecular formula C13H7BrCl2N2 and a molecular weight of 342.02 g/mol. Its IUPAC name is 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine.
| Compound Name | 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine |
|---|---|
| PubChem CID | 21354222 |
| Molecular Formula | C13H7BrCl2N2 |
| Molecular Weight | 342.02 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine |
| SMILES | [C-]#[N+]C(c1ccc(Br)cn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H7BrCl2N2/c1-17-13(11-6-5-8(14)7-18-11)12-9(15)3-2-4-10(12)16/h2-7,13H |
| InChIKey | FSVQPVMBBYCOJV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|