C15H14BrClN2S — CID 114864888
N-[[2-[(5-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]methyl]cyclopropanamine (PubChem CID 114864888) has the molecular formula C15H14BrClN2S and a molecular weight of 369.72 g/mol. Its IUPAC name is N-[[2-[(5-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(5-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114864888 |
| Molecular Formula | C15H14BrClN2S |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | N-[[2-[(5-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]methyl]cyclopropanamine |
| SMILES | Clc1ccc(CNC2CC2)c(Sc2ccc(Br)cn2)c1 |
| InChI | InChI=1S/C15H14BrClN2S/c16-11-2-6-15(19-9-11)20-14-7-12(17)3-1-10(14)8-18-13-4-5-13/h1-3,6-7,9,13,18H,4-5,8H2 |
| InChIKey | FJGDSYHZJLZINM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |