C14H14ClN3OS — CID 114864238
2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 114864238) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114864238 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(Sc2cc(Cl)ccc2CNC2CC2)[nH]1 |
| InChI | InChI=1S/C14H14ClN3OS/c15-10-2-1-9(8-17-11-3-4-11)12(7-10)20-14-16-6-5-13(19)18-14/h1-2,5-7,11,17H,3-4,8H2,(H,16,18,19) |
| InChIKey | WRROWSMGDMOGJZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |